Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C8H16/c1-4-6-7-8(3)5-2/h6-8H,4-5H2,1-3H3/b7-6+

  1. 3-Heptene, 5-methyl-
  2. 3-Heptene, 5-methyl-, trans

Stereoisomers