Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h5-6,8H,4,7H2,1-3H3/b6-5-

  1. 6-Methyl-cis-3-heptene
  2. 3-Heptene, 6-methyl-, cis

Stereoisomers