Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4-/m0/s1

  1. 2,3-Butanediol, [R-(R*,R*)]-
  2. 2,3-Butanediol, rac
  3. 2,3-Butanediol, (R,R)

Stereoisomers