Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C14H24/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h11-14H,1-10H2

  1. Phenanthrene, tetradecahydro-
  2. Tricyclo[8.4.0.0(2,7)]dodecane, isomer # 1
  3. Tricyclo[8.4.0.0(2,7)]dodecane, isomer # 2
  4. Tricyclo[8.4.0.0(2,7)]dodecane, isomer # 3
  5. Tricyclo[8.4.0.0(2,7)]dodecane, isomer # 4

Stereoisomers