Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11+,12-/m1/s1

  1. isopulegol acetate
  2. Isopulegol acetate

Stereoisomers