Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C11H14O3/c1-4-5-8-6-9(13-2)11(12)10(7-8)14-3/h4-7,12H,1-3H3/b5-4+

  1. (E)-2,6-Dimethoxy-4-(prop-1-en-1-yl)phenol
  2. Phenol, 4-(1-propenyl)-2,6-dimethoxy
  3. (E)-4-Propenylsyringol

Stereoisomers