Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C9H20/c1-4-5-6-7-8-9(2)3/h9H,4-8H2,1-3H3

  1. Octane, 2-methyl-
  2. (3RS,4SR)-dimethylheptane
  3. (3RS,4RS)-dimethylheptane
  4. (3RS,5SR)-dimethylheptane
  5. (3RS,5RS)-dimethylheptane