Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C6H14OS/c1-2-3-6(8)4-5-7/h6-8H,2-5H2,1H3

  1. 3-mercaptohexanol
  2. 3-Mercapto-1-hexanol
  3. 3-Mercaptohexan-1-ol
  4. 3-Mercaptohexanol