Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C6H12O2S/c1-5(9)3-4-8-6(2)7/h5,9H,3-4H2,1-2H3

  1. 3-mercaptobutyl-acetate
  2. 3-Mercaptobutylacetate
  3. 3-Mercaptobutyl-1-acetate
  4. 3-Sulfanylbutyl acetate