Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C5H12OS/c1-4(3-6)5(2)7/h4-7H,3H2,1-2H3

  1. 2-methyl-3-sulfanyl-butan-1-ol
  2. 3-Mercapto-2-methyl-1-butanol
  3. 3-Mercapto-2-methylbutanol
  4. 3-Sulfanyl-2-methylbutan-1-ol