Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C5H10OS/c1-2-5(6)3-4-7/h7H,2-4H2,1H3

  1. 1-mercaptopentan-3-one
  2. 1-Mercaptopentan-3-one
  3. 1-Mercapto-3-pentanone
  4. 1-Sulfanylpentan-3-one