Home Symbol which looks like a small house Up Solid circle with an upward pointer in it

Search Results

Matches found

The following matching species were found for the submitted IUPAC International Chemical Identifier:

InChI=1S/C4H10OS/c1-4(6)2-3-5/h4-6H,2-3H2,1H3

  1. 3-mercaptobutanol
  2. 3-Mercapto-1-butanol
  3. 3-Mercaptobutanol
  4. 3-Sulfanylbutan-1-ol